C15H24BrN5 — CID 114536466
N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine (PubChem CID 114536466) has the molecular formula C15H24BrN5 and a molecular weight of 354.30 g/mol. Its IUPAC name is N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine.
| Compound Name | N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 114536466 |
| Molecular Formula | C15H24BrN5 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine |
| SMILES | CCc1nn(C)c(CNCCCn2nc(C)cc2C)c1Br |
| InChI | InChI=1S/C15H24BrN5/c1-5-13-15(16)14(20(4)19-13)10-17-7-6-8-21-12(3)9-11(2)18-21/h9,17H,5-8,10H2,1-4H3 |
| InChIKey | ICPFDEXRNNGXRA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|