C14H23N5S — CID 114536982
5,6-dimethyl-3-(3,4,5-trimethylpiperazin-1-yl)pyridazine-4-carbothioamide (PubChem CID 114536982) has the molecular formula C14H23N5S and a molecular weight of 293.44 g/mol. Its IUPAC name is 5,6-dimethyl-3-(3,4,5-trimethylpiperazin-1-yl)pyridazine-4-carbothioamide.
| Compound Name | 5,6-dimethyl-3-(3,4,5-trimethylpiperazin-1-yl)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 114536982 |
| Molecular Formula | C14H23N5S |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 5,6-dimethyl-3-(3,4,5-trimethylpiperazin-1-yl)pyridazine-4-carbothioamide |
| SMILES | Cc1nnc(N2CC(C)N(C)C(C)C2)c(C(N)=S)c1C |
| InChI | InChI=1S/C14H23N5S/c1-8-6-19(7-9(2)18(8)5)14-12(13(15)20)10(3)11(4)16-17-14/h8-9H,6-7H2,1-5H3,(H2,15,20) |
| InChIKey | UKPJOLHSGFRGSF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|