C16H25N3O2 — CID 114537156
8-[(3,4,5-trimethylpiperazin-1-yl)methyl]-4H-1,3-benzodioxin-6-amine (PubChem CID 114537156) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 8-[(3,4,5-trimethylpiperazin-1-yl)methyl]-4H-1,3-benzodioxin-6-amine.
| Compound Name | 8-[(3,4,5-trimethylpiperazin-1-yl)methyl]-4H-1,3-benzodioxin-6-amine |
|---|---|
| PubChem CID | 114537156 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 8-[(3,4,5-trimethylpiperazin-1-yl)methyl]-4H-1,3-benzodioxin-6-amine |
| SMILES | CC1CN(Cc2cc(N)cc3c2OCOC3)CC(C)N1C |
| InChI | InChI=1S/C16H25N3O2/c1-11-6-19(7-12(2)18(11)3)8-13-4-15(17)5-14-9-20-10-21-16(13)14/h4-5,11-12H,6-10,17H2,1-3H3 |
| InChIKey | CWGVABMNGVGJMT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|