6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid

C12H18N4O2 — CID 114537374

IUPAC6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid
SMILESCC1CN(c2ccc(C(=O)O)nn2)CC(C)N1C
InChIInChI=1S/C12H18N4O2/c1-8-6-16(7-9(2)15(8)3)11-5-4-10(12(17)18)13-14-11/h4-5,8-9H,6-7H2,1-3H3,(H,17,18)
InChIKeyHIJIZJQRNWAPBV-UHFFFAOYSA-N
MW250.30 g/mol
LogP0.70
Rot. Bonds2

About 6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid

6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid (PubChem CID 114537374) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid.

Molecular Properties

Compound Name6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid
PubChem CID114537374
Molecular FormulaC12H18N4O2
Molecular Weight250.30 g/mol
Exact Mass250.14
IUPAC Name6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid
SMILESCC1CN(c2ccc(C(=O)O)nn2)CC(C)N1C
InChIInChI=1S/C12H18N4O2/c1-8-6-16(7-9(2)15(8)3)11-5-4-10(12(17)18)13-14-11/h4-5,8-9H,6-7H2,1-3H3,(H,17,18)
InChIKeyHIJIZJQRNWAPBV-UHFFFAOYSA-N
XLogP0.70
TPSA69.56 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.30
LogP ≤ 50.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid?
The IUPAC name of 6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid (CID 114537374) is 6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid.
What is the SMILES notation for 6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid?
The canonical SMILES for 6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid is CC1CN(c2ccc(C(=O)O)nn2)CC(C)N1C.
What is the InChIKey of 6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid?
The InChIKey is HIJIZJQRNWAPBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O2/c1-8-6-16(7-9(2)15(8)3)11-5-4-10(12(17)18)13-14-11/h4-5,8-9H,6-7H2,1-3H3,(H,17,18).
What are the key properties of 6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid?
6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid has a molecular weight of 250.30 g/mol, XLogP of 0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4,5-trimethylpiperazin-1-yl)pyridazine-3-carboxylic acid is sourced from PubChem (CID 114537374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).