C24H32F3N3O2 — CID 11453751
4,4-dimethyl-1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]cyclohexyl]piperidine-2,6-dione (PubChem CID 11453751) has the molecular formula C24H32F3N3O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 4,4-dimethyl-1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]cyclohexyl]piperidine-2,6-dione.
| Compound Name | 4,4-dimethyl-1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]cyclohexyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 11453751 |
| Molecular Formula | C24H32F3N3O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 4,4-dimethyl-1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]cyclohexyl]piperidine-2,6-dione |
| SMILES | CC1(C)CC(=O)N(C2CCC(N3CCN(c4cccc(C(F)(F)F)c4)CC3)CC2)C(=O)C1 |
| InChI | InChI=1S/C24H32F3N3O2/c1-23(2)15-21(31)30(22(32)16-23)19-8-6-18(7-9-19)28-10-12-29(13-11-28)20-5-3-4-17(14-20)24(25,26)27/h3-5,14,18-19H,6-13,15-16H2,1-2H3 |
| InChIKey | SWCGWBOIEXHVNM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|