C17H29N3 — CID 114537626
2-(2-ethylphenyl)-2-(3,4,5-trimethylpiperazin-1-yl)ethanamine (PubChem CID 114537626) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is 2-(2-ethylphenyl)-2-(3,4,5-trimethylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(2-ethylphenyl)-2-(3,4,5-trimethylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 114537626 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | 2-(2-ethylphenyl)-2-(3,4,5-trimethylpiperazin-1-yl)ethanamine |
| SMILES | CCc1ccccc1C(CN)N1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C17H29N3/c1-5-15-8-6-7-9-16(15)17(10-18)20-11-13(2)19(4)14(3)12-20/h6-9,13-14,17H,5,10-12,18H2,1-4H3 |
| InChIKey | CJCHFXXPNGOVAI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |