About 4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine
4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine (PubChem CID 114538487) has the molecular formula C14H20ClFN2
and a molecular weight of 270.78 g/mol. Its IUPAC name is 4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine.
Molecular Properties
| Compound Name | 4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine |
| PubChem CID | 114538487 |
| Molecular Formula | C14H20ClFN2 |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine |
| SMILES | CC1CN(c2ccc(CCl)cc2F)CC(C)N1C |
| InChI | InChI=1S/C14H20ClFN2/c1-10-8-18(9-11(2)17(10)3)14-5-4-12(7-15)6-13(14)16/h4-6,10-11H,7-9H2,1-3H3 |
| InChIKey | OMTWXPJBTXLUQP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine?
The IUPAC name of 4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine (CID 114538487) is 4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine.
What is the SMILES notation for 4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine?
The canonical SMILES for 4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine is CC1CN(c2ccc(CCl)cc2F)CC(C)N1C.
What is the InChIKey of 4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine?
The InChIKey is OMTWXPJBTXLUQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClFN2/c1-10-8-18(9-11(2)17(10)3)14-5-4-12(7-15)6-13(14)16/h4-6,10-11H,7-9H2,1-3H3.
What are the key properties of 4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine?
4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine has a molecular weight of 270.78 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(chloromethyl)-2-fluorophenyl]-1,2,6-trimethylpiperazine is sourced from PubChem (CID 114538487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).