C11H22N4 — CID 114539222
2-amino-4-(3,4,5-trimethylpiperazin-1-yl)butanenitrile (PubChem CID 114539222) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-amino-4-(3,4,5-trimethylpiperazin-1-yl)butanenitrile.
| Compound Name | 2-amino-4-(3,4,5-trimethylpiperazin-1-yl)butanenitrile |
|---|---|
| PubChem CID | 114539222 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 2-amino-4-(3,4,5-trimethylpiperazin-1-yl)butanenitrile |
| SMILES | CC1CN(CCC(N)C#N)CC(C)N1C |
| InChI | InChI=1S/C11H22N4/c1-9-7-15(5-4-11(13)6-12)8-10(2)14(9)3/h9-11H,4-5,7-8,13H2,1-3H3 |
| InChIKey | XCOPDKNMMJQSQQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 56.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |