C11H14ClFN2 — CID 114539767
5-chloro-3-fluoro-N-(3-methylcyclopentyl)pyridin-2-amine (PubChem CID 114539767) has the molecular formula C11H14ClFN2 and a molecular weight of 228.70 g/mol. Its IUPAC name is 5-chloro-3-fluoro-N-(3-methylcyclopentyl)pyridin-2-amine.
| Compound Name | 5-chloro-3-fluoro-N-(3-methylcyclopentyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114539767 |
| Molecular Formula | C11H14ClFN2 |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 5-chloro-3-fluoro-N-(3-methylcyclopentyl)pyridin-2-amine |
| SMILES | CC1CCC(Nc2ncc(Cl)cc2F)C1 |
| InChI | InChI=1S/C11H14ClFN2/c1-7-2-3-9(4-7)15-11-10(13)5-8(12)6-14-11/h5-7,9H,2-4H2,1H3,(H,14,15) |
| InChIKey | DNVDHNUKAJGPRL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |