C16H25ClN2O — CID 114539808
1-(4-chlorophenyl)-3-(3,4,5-trimethylpiperazin-1-yl)propan-1-ol (PubChem CID 114539808) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(3,4,5-trimethylpiperazin-1-yl)propan-1-ol.
| Compound Name | 1-(4-chlorophenyl)-3-(3,4,5-trimethylpiperazin-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 114539808 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3,4,5-trimethylpiperazin-1-yl)propan-1-ol |
| SMILES | CC1CN(CCC(O)c2ccc(Cl)cc2)CC(C)N1C |
| InChI | InChI=1S/C16H25ClN2O/c1-12-10-19(11-13(2)18(12)3)9-8-16(20)14-4-6-15(17)7-5-14/h4-7,12-13,16,20H,8-11H2,1-3H3 |
| InChIKey | UQZVXWCNKNNQGU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |