C24H38N2O7 — CID 11454115
tert-butyl (3aS,4R,6R,6aR)-6-[[[(1R)-2-hydroxy-1-phenylethyl]amino]methyl]-4-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 11454115) has the molecular formula C24H38N2O7 and a molecular weight of 466.58 g/mol. Its IUPAC name is tert-butyl (3aS,4R,6R,6aR)-6-[[[(1R)-2-hydroxy-1-phenylethyl]amino]methyl]-4-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,4R,6R,6aR)-6-[[[(1R)-2-hydroxy-1-phenylethyl]amino]methyl]-4-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 11454115 |
| Molecular Formula | C24H38N2O7 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | tert-butyl (3aS,4R,6R,6aR)-6-[[[(1R)-2-hydroxy-1-phenylethyl]amino]methyl]-4-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | COCOC[C@@H]1[C@@H]2OC(C)(C)O[C@@H]2[C@@H](CN[C@@H](CO)c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38N2O7/c1-23(2,3)33-22(28)26-18(12-25-17(13-27)16-10-8-7-9-11-16)20-21(32-24(4,5)31-20)19(26)14-30-15-29-6/h7-11,17-21,25,27H,12-15H2,1-6H3/t17-,18+,19+,20+,21-/m0/s1 |
| InChIKey | KILVIBLVNPGGSB-QSUVIHHLSA-N |
| XLogP | 2.44 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|