C9H19N3 — CID 114541310
1-(3,4,5-trimethylpiperazin-1-yl)ethanimine (PubChem CID 114541310) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-(3,4,5-trimethylpiperazin-1-yl)ethanimine.
| Compound Name | 1-(3,4,5-trimethylpiperazin-1-yl)ethanimine |
|---|---|
| PubChem CID | 114541310 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 1-(3,4,5-trimethylpiperazin-1-yl)ethanimine |
| SMILES | [H]/N=C(\C)N1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C9H19N3/c1-7-5-12(9(3)10)6-8(2)11(7)4/h7-8,10H,5-6H2,1-4H3/b10-9+ |
| InChIKey | OCUCQWNRMNYKMK-MDZDMXLPSA-N |
| XLogP | 1.01 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|