C12H19N3 — CID 114541918
2-N-methyl-4-N-(3-methylcyclopentyl)pyridine-2,4-diamine (PubChem CID 114541918) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 2-N-methyl-4-N-(3-methylcyclopentyl)pyridine-2,4-diamine.
| Compound Name | 2-N-methyl-4-N-(3-methylcyclopentyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 114541918 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 2-N-methyl-4-N-(3-methylcyclopentyl)pyridine-2,4-diamine |
| SMILES | CNc1cc(NC2CCC(C)C2)ccn1 |
| InChI | InChI=1S/C12H19N3/c1-9-3-4-10(7-9)15-11-5-6-14-12(8-11)13-2/h5-6,8-10H,3-4,7H2,1-2H3,(H2,13,14,15) |
| InChIKey | YPYHBQYTLYZBDS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |