C22H44OSiSn — CID 11454222
[(E,4R)-4-methoxy-6-tributylstannylhex-5-en-1-ynyl]-trimethylsilane (PubChem CID 11454222) has the molecular formula C22H44OSiSn and a molecular weight of 471.39 g/mol. Its IUPAC name is [(E,4R)-4-methoxy-6-tributylstannylhex-5-en-1-ynyl]-trimethylsilane.
| Compound Name | [(E,4R)-4-methoxy-6-tributylstannylhex-5-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11454222 |
| Molecular Formula | C22H44OSiSn |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | [(E,4R)-4-methoxy-6-tributylstannylhex-5-en-1-ynyl]-trimethylsilane |
| SMILES | CCCC[Sn](/C=C/[C@@H](CC#C[Si](C)(C)C)OC)(CCCC)CCCC |
| InChI | InChI=1S/C10H17OSi.3C4H9.Sn/c1-6-10(11-2)8-7-9-12(3,4)5;3*1-3-4-2;/h1,6,10H,8H2,2-5H3;3*1,3-4H2,2H3;/t10-;;;;/m0..../s1 |
| InChIKey | IYGJYGAWQOCAIC-CZEDPBFNSA-N |
| XLogP | 7.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|