C11H20N6 — CID 114542352
4-N-(3,3-dimethylcyclopentyl)-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 114542352) has the molecular formula C11H20N6 and a molecular weight of 236.32 g/mol. Its IUPAC name is 4-N-(3,3-dimethylcyclopentyl)-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(3,3-dimethylcyclopentyl)-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114542352 |
| Molecular Formula | C11H20N6 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 4-N-(3,3-dimethylcyclopentyl)-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | CC1(C)CCC(Nc2cc(NN)nc(N)n2)C1 |
| InChI | InChI=1S/C11H20N6/c1-11(2)4-3-7(6-11)14-8-5-9(17-13)16-10(12)15-8/h5,7H,3-4,6,13H2,1-2H3,(H4,12,14,15,16,17) |
| InChIKey | OHEDBJATUXHYOZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|