About benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate
benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate (PubChem CID 11454242) has the molecular formula C28H41NO5
and a molecular weight of 471.64 g/mol. Its IUPAC name is benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate.
Molecular Properties
| Compound Name | benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate |
| PubChem CID | 11454242 |
| Molecular Formula | C28H41NO5 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate |
| SMILES | COC(CN(CCCCCCOCCCCc1ccccc1)C(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C28H41NO5/c1-31-27(32-2)23-29(28(30)34-24-26-18-9-6-10-19-26)20-12-3-4-13-21-33-22-14-11-17-25-15-7-5-8-16-25/h5-10,15-16,18-19,27H,3-4,11-14,17,20-24H2,1-2H3 |
| InChIKey | NHZPWFUYBUSPHT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate?
The IUPAC name of benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate (CID 11454242) is benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate.
What is the SMILES notation for benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate?
The canonical SMILES for benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate is COC(CN(CCCCCCOCCCCc1ccccc1)C(=O)OCc1ccccc1)OC.
What is the InChIKey of benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate?
The InChIKey is NHZPWFUYBUSPHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H41NO5/c1-31-27(32-2)23-29(28(30)34-24-26-18-9-6-10-19-26)20-12-3-4-13-21-33-22-14-11-17-25-15-7-5-8-16-25/h5-10,15-16,18-19,27H,3-4,11-14,17,20-24H2,1-2H3.
What are the key properties of benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate?
benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate has a molecular weight of 471.64 g/mol, XLogP of 5.84, 18 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-(2,2-dimethoxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate is sourced from PubChem (CID 11454242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).