C15H21N5 — CID 114543048
4-(3,4,5-trimethylpiperazin-1-yl)quinazolin-7-amine (PubChem CID 114543048) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 4-(3,4,5-trimethylpiperazin-1-yl)quinazolin-7-amine.
| Compound Name | 4-(3,4,5-trimethylpiperazin-1-yl)quinazolin-7-amine |
|---|---|
| PubChem CID | 114543048 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 4-(3,4,5-trimethylpiperazin-1-yl)quinazolin-7-amine |
| SMILES | CC1CN(c2ncnc3cc(N)ccc23)CC(C)N1C |
| InChI | InChI=1S/C15H21N5/c1-10-7-20(8-11(2)19(10)3)15-13-5-4-12(16)6-14(13)17-9-18-15/h4-6,9-11H,7-8,16H2,1-3H3 |
| InChIKey | IJVZLWTYCQAWIM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|