C16H11F4N5O4S2 — CID 11454377
2,3,5,6-tetrafluoro-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]benzenesulfonamide (PubChem CID 11454377) has the molecular formula C16H11F4N5O4S2 and a molecular weight of 477.42 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]benzenesulfonamide.
| Compound Name | 2,3,5,6-tetrafluoro-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 11454377 |
| Molecular Formula | C16H11F4N5O4S2 |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2ccnc(NS(=O)(=O)c3c(F)c(F)cc(F)c3F)n2)cc1 |
| InChI | InChI=1S/C16H11F4N5O4S2/c17-10-7-11(18)14(20)15(13(10)19)31(28,29)25-16-22-6-5-12(24-16)23-8-1-3-9(4-2-8)30(21,26)27/h1-7H,(H2,21,26,27)(H2,22,23,24,25) |
| InChIKey | CUGGDVKGBBEBHY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|