About 3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine
3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine (PubChem CID 114543830) has the molecular formula C12H22F3N
and a molecular weight of 237.31 g/mol. Its IUPAC name is 3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine.
Molecular Properties
| Compound Name | 3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine |
| PubChem CID | 114543830 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine |
| SMILES | CC1CCC(NC(C)CCCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H22F3N/c1-9-5-6-11(8-9)16-10(2)4-3-7-12(13,14)15/h9-11,16H,3-8H2,1-2H3 |
| InChIKey | CDYCHBVEYMUDEC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine?
The IUPAC name of 3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine (CID 114543830) is 3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine.
What is the SMILES notation for 3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine?
The canonical SMILES for 3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine is CC1CCC(NC(C)CCCC(F)(F)F)C1.
What is the InChIKey of 3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine?
The InChIKey is CDYCHBVEYMUDEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3N/c1-9-5-6-11(8-9)16-10(2)4-3-7-12(13,14)15/h9-11,16H,3-8H2,1-2H3.
What are the key properties of 3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine?
3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine has a molecular weight of 237.31 g/mol, XLogP of 3.89, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-(6,6,6-trifluorohexan-2-yl)cyclopentan-1-amine is sourced from PubChem (CID 114543830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).