C28H54N4O2 — CID 11454420
(4R)-1-[4-[(4R)-4-heptyl-2-oxo-1,5-diazocan-1-yl]butyl]-4-pentyl-1,5-diazocan-2-one (PubChem CID 11454420) has the molecular formula C28H54N4O2 and a molecular weight of 478.77 g/mol. Its IUPAC name is (4R)-1-[4-[(4R)-4-heptyl-2-oxo-1,5-diazocan-1-yl]butyl]-4-pentyl-1,5-diazocan-2-one.
| Compound Name | (4R)-1-[4-[(4R)-4-heptyl-2-oxo-1,5-diazocan-1-yl]butyl]-4-pentyl-1,5-diazocan-2-one |
|---|---|
| PubChem CID | 11454420 |
| Molecular Formula | C28H54N4O2 |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.42 |
| IUPAC Name | (4R)-1-[4-[(4R)-4-heptyl-2-oxo-1,5-diazocan-1-yl]butyl]-4-pentyl-1,5-diazocan-2-one |
| SMILES | CCCCCCC[C@@H]1CC(=O)N(CCCCN2CCCN[C@H](CCCCC)CC2=O)CCCN1 |
| InChI | InChI=1S/C28H54N4O2/c1-3-5-7-8-10-16-26-24-28(34)32(22-14-18-30-26)20-12-11-19-31-21-13-17-29-25(23-27(31)33)15-9-6-4-2/h25-26,29-30H,3-24H2,1-2H3/t25-,26-/m1/s1 |
| InChIKey | MMZYGGYTZKDTCP-CLJLJLNGSA-N |
| XLogP | 4.87 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|