C19H37N — CID 114544295
N-(3,3-dimethylcyclopentyl)cyclododecanamine (PubChem CID 114544295) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)cyclododecanamine.
| Compound Name | N-(3,3-dimethylcyclopentyl)cyclododecanamine |
|---|---|
| PubChem CID | 114544295 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)cyclododecanamine |
| SMILES | CC1(C)CCC(NC2CCCCCCCCCCC2)C1 |
| InChI | InChI=1S/C19H37N/c1-19(2)15-14-18(16-19)20-17-12-10-8-6-4-3-5-7-9-11-13-17/h17-18,20H,3-16H2,1-2H3 |
| InChIKey | VMVKMZQTGLIRDW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |