C25H41NO2S2Si — CID 11454441
(2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloctan-1-one (PubChem CID 11454441) has the molecular formula C25H41NO2S2Si and a molecular weight of 479.83 g/mol. Its IUPAC name is (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloctan-1-one.
| Compound Name | (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloctan-1-one |
|---|---|
| PubChem CID | 11454441 |
| Molecular Formula | C25H41NO2S2Si |
| Molecular Weight | 479.83 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloctan-1-one |
| SMILES | CCCCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)N1C(=S)SC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C25H41NO2S2Si/c1-8-9-11-16-22(28-31(6,7)25(3,4)5)19(2)23(27)26-21(18-30-24(26)29)17-20-14-12-10-13-15-20/h10,12-15,19,21-22H,8-9,11,16-18H2,1-7H3/t19-,21-,22+/m0/s1 |
| InChIKey | QQBPQZCNXVGGBA-ILWGZMRPSA-N |
| XLogP | 7.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.83 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|