C13H26N2O — CID 114544886
4-(aminomethyl)-N-(3,3-dimethylcyclopentyl)oxan-4-amine (PubChem CID 114544886) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(3,3-dimethylcyclopentyl)oxan-4-amine.
| Compound Name | 4-(aminomethyl)-N-(3,3-dimethylcyclopentyl)oxan-4-amine |
|---|---|
| PubChem CID | 114544886 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 4-(aminomethyl)-N-(3,3-dimethylcyclopentyl)oxan-4-amine |
| SMILES | CC1(C)CCC(NC2(CN)CCOCC2)C1 |
| InChI | InChI=1S/C13H26N2O/c1-12(2)4-3-11(9-12)15-13(10-14)5-7-16-8-6-13/h11,15H,3-10,14H2,1-2H3 |
| InChIKey | TWSIWCMSLHVITM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |