About N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine
N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine (PubChem CID 114545027) has the molecular formula C15H28N4
and a molecular weight of 264.42 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine |
| PubChem CID | 114545027 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine |
| SMILES | CCCn1cncc1C(CN)NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C15H28N4/c1-4-7-19-11-17-10-14(19)13(9-16)18-12-5-6-15(2,3)8-12/h10-13,18H,4-9,16H2,1-3H3 |
| InChIKey | HZICMFROLBRQRF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine?
The IUPAC name of N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine (CID 114545027) is N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine?
The canonical SMILES for N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine is CCCn1cncc1C(CN)NC1CCC(C)(C)C1.
What is the InChIKey of N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine?
The InChIKey is HZICMFROLBRQRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N4/c1-4-7-19-11-17-10-14(19)13(9-16)18-12-5-6-15(2,3)8-12/h10-13,18H,4-9,16H2,1-3H3.
What are the key properties of N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine?
N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine has a molecular weight of 264.42 g/mol, XLogP of 2.46, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylcyclopentyl)-1-(3-propylimidazol-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 114545027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).