C18H11Cl4N3O3S — CID 11454662
3-chloro-4-(2-hydroxyphenyl)-1-[5-[(2,4,6-trichlorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]azetidin-2-one (PubChem CID 11454662) has the molecular formula C18H11Cl4N3O3S and a molecular weight of 491.18 g/mol. Its IUPAC name is 3-chloro-4-(2-hydroxyphenyl)-1-[5-[(2,4,6-trichlorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]azetidin-2-one.
| Compound Name | 3-chloro-4-(2-hydroxyphenyl)-1-[5-[(2,4,6-trichlorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]azetidin-2-one |
|---|---|
| PubChem CID | 11454662 |
| Molecular Formula | C18H11Cl4N3O3S |
| Molecular Weight | 491.18 g/mol |
| Exact Mass | 488.93 |
| IUPAC Name | 3-chloro-4-(2-hydroxyphenyl)-1-[5-[(2,4,6-trichlorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]azetidin-2-one |
| SMILES | O=C1C(Cl)C(c2ccccc2O)N1c1nnc(COc2c(Cl)cc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C18H11Cl4N3O3S/c19-8-5-10(20)16(11(21)6-8)28-7-13-23-24-18(29-13)25-15(14(22)17(25)27)9-3-1-2-4-12(9)26/h1-6,14-15,26H,7H2 |
| InChIKey | KQSOBRMONPKCQB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.18 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|