About 4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine
4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine (PubChem CID 114547049) has the molecular formula C13H25N3
and a molecular weight of 223.36 g/mol. Its IUPAC name is 4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine.
Molecular Properties
| Compound Name | 4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine |
| PubChem CID | 114547049 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine |
| SMILES | CC(CN1CC(C)N(C)C(C)C1)=C1CNC1 |
| InChI | InChI=1S/C13H25N3/c1-10(13-5-14-6-13)7-16-8-11(2)15(4)12(3)9-16/h11-12,14H,5-9H2,1-4H3 |
| InChIKey | HEVSOLLPXACHRS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine?
The IUPAC name of 4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine (CID 114547049) is 4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine.
What is the SMILES notation for 4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine?
The canonical SMILES for 4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine is CC(CN1CC(C)N(C)C(C)C1)=C1CNC1.
What is the InChIKey of 4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine?
The InChIKey is HEVSOLLPXACHRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3/c1-10(13-5-14-6-13)7-16-8-11(2)15(4)12(3)9-16/h11-12,14H,5-9H2,1-4H3.
What are the key properties of 4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine?
4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine has a molecular weight of 223.36 g/mol, XLogP of 0.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(azetidin-3-ylidene)propyl]-1,2,6-trimethylpiperazine is sourced from PubChem (CID 114547049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).