C14H22N2 — CID 114547176
N'-(3-methylcyclopentyl)-1-phenylethane-1,2-diamine (PubChem CID 114547176) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N'-(3-methylcyclopentyl)-1-phenylethane-1,2-diamine.
| Compound Name | N'-(3-methylcyclopentyl)-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 114547176 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N'-(3-methylcyclopentyl)-1-phenylethane-1,2-diamine |
| SMILES | CC1CCC(NCC(N)c2ccccc2)C1 |
| InChI | InChI=1S/C14H22N2/c1-11-7-8-13(9-11)16-10-14(15)12-5-3-2-4-6-12/h2-6,11,13-14,16H,7-10,15H2,1H3 |
| InChIKey | CKMDNPHGHNLKIM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |