C26H27ClN4O2S — CID 11454736
5-(4-chlorophenyl)-N'-methyl-4-phenyl-N-(2,4,6-trimethylphenyl)sulfonyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 11454736) has the molecular formula C26H27ClN4O2S and a molecular weight of 495.05 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N'-methyl-4-phenyl-N-(2,4,6-trimethylphenyl)sulfonyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N'-methyl-4-phenyl-N-(2,4,6-trimethylphenyl)sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 11454736 |
| Molecular Formula | C26H27ClN4O2S |
| Molecular Weight | 495.05 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 5-(4-chlorophenyl)-N'-methyl-4-phenyl-N-(2,4,6-trimethylphenyl)sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | C/N=C(/NS(=O)(=O)c1c(C)cc(C)cc1C)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C26H27ClN4O2S/c1-17-14-18(2)25(19(3)15-17)34(32,33)30-26(28-4)31-16-23(20-8-6-5-7-9-20)24(29-31)21-10-12-22(27)13-11-21/h5-15,23H,16H2,1-4H3,(H,28,30) |
| InChIKey | JTASXWYBHGSGFN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.05 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|