C9H14N4O2 — CID 114547852
6-[(3-methylcyclopentyl)amino]-2H-1,2,4-triazine-3,5-dione (PubChem CID 114547852) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 6-[(3-methylcyclopentyl)amino]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(3-methylcyclopentyl)amino]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 114547852 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 6-[(3-methylcyclopentyl)amino]-2H-1,2,4-triazine-3,5-dione |
| SMILES | CC1CCC(Nc2n[nH]c(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C9H14N4O2/c1-5-2-3-6(4-5)10-7-8(14)11-9(15)13-12-7/h5-6H,2-4H2,1H3,(H,10,12)(H2,11,13,14,15) |
| InChIKey | DGWYOLRYUBIUKB-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |