C32H39N3O2 — CID 11454795
(1S,14S,15S,18S,19S,22S,23R)-4-ethyl-19-hydroxy-14,18-dimethyl-7-phenyl-4,6,8-triazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),5,7,10-tetraen-9-one (PubChem CID 11454795) has the molecular formula C32H39N3O2 and a molecular weight of 497.68 g/mol. Its IUPAC name is (1S,14S,15S,18S,19S,22S,23R)-4-ethyl-19-hydroxy-14,18-dimethyl-7-phenyl-4,6,8-triazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),5,7,10-tetraen-9-one.
| Compound Name | (1S,14S,15S,18S,19S,22S,23R)-4-ethyl-19-hydroxy-14,18-dimethyl-7-phenyl-4,6,8-triazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),5,7,10-tetraen-9-one |
|---|---|
| PubChem CID | 11454795 |
| Molecular Formula | C32H39N3O2 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | (1S,14S,15S,18S,19S,22S,23R)-4-ethyl-19-hydroxy-14,18-dimethyl-7-phenyl-4,6,8-triazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),5,7,10-tetraen-9-one |
| SMILES | CCn1c2nc(-c3ccccc3)nc(=O)c-2cc2c1C[C@@H]1CC[C@@H]3[C@H](CC[C@]4(C)[C@@H](O)CC[C@@H]34)[C@@]1(C)C2 |
| InChI | InChI=1S/C32H39N3O2/c1-4-35-26-17-21-10-11-22-24-12-13-27(36)31(24,2)15-14-25(22)32(21,3)18-20(26)16-23-29(35)33-28(34-30(23)37)19-8-6-5-7-9-19/h5-9,16,21-22,24-25,27,36H,4,10-15,17-18H2,1-3H3/t21-,22-,24-,25-,27-,31-,32-/m0/s1 |
| InChIKey | KZHJJFGXJDCZEP-LXBVULDHSA-N |
| XLogP | 5.75 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |