C10H15ClN2S — CID 114548067
4-chloro-N-(3,3-dimethylcyclopentyl)-1,3-thiazol-2-amine (PubChem CID 114548067) has the molecular formula C10H15ClN2S and a molecular weight of 230.76 g/mol. Its IUPAC name is 4-chloro-N-(3,3-dimethylcyclopentyl)-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-N-(3,3-dimethylcyclopentyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114548067 |
| Molecular Formula | C10H15ClN2S |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-chloro-N-(3,3-dimethylcyclopentyl)-1,3-thiazol-2-amine |
| SMILES | CC1(C)CCC(Nc2nc(Cl)cs2)C1 |
| InChI | InChI=1S/C10H15ClN2S/c1-10(2)4-3-7(5-10)12-9-13-8(11)6-14-9/h6-7H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | OQKHUENBNCRMDE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |