About 5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide
5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide (PubChem CID 114548138) has the molecular formula C12H19BrN4O2S
and a molecular weight of 363.28 g/mol. Its IUPAC name is 5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide |
| PubChem CID | 114548138 |
| Molecular Formula | C12H19BrN4O2S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide |
| SMILES | CC1(C)CCC(NS(=O)(=O)c2cc(Br)cnc2NN)C1 |
| InChI | InChI=1S/C12H19BrN4O2S/c1-12(2)4-3-9(6-12)17-20(18,19)10-5-8(13)7-15-11(10)16-14/h5,7,9,17H,3-4,6,14H2,1-2H3,(H,15,16) |
| InChIKey | JERSVECRYIFBIT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide?
The IUPAC name of 5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide (CID 114548138) is 5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide.
What is the SMILES notation for 5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide?
The canonical SMILES for 5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide is CC1(C)CCC(NS(=O)(=O)c2cc(Br)cnc2NN)C1.
What is the InChIKey of 5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide?
The InChIKey is JERSVECRYIFBIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19BrN4O2S/c1-12(2)4-3-9(6-12)17-20(18,19)10-5-8(13)7-15-11(10)16-14/h5,7,9,17H,3-4,6,14H2,1-2H3,(H,15,16).
What are the key properties of 5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide?
5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide has a molecular weight of 363.28 g/mol, XLogP of 1.99, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(3,3-dimethylcyclopentyl)-2-hydrazinylpyridine-3-sulfonamide is sourced from PubChem (CID 114548138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).