C15H23ClN4 — CID 114548654
5-(1-chloroethyl)-6-(3,3-dimethylcyclopentyl)-1,3-dimethylimidazo[4,5-d]pyrazole (PubChem CID 114548654) has the molecular formula C15H23ClN4 and a molecular weight of 294.83 g/mol. Its IUPAC name is 5-(1-chloroethyl)-6-(3,3-dimethylcyclopentyl)-1,3-dimethylimidazo[4,5-d]pyrazole.
| Compound Name | 5-(1-chloroethyl)-6-(3,3-dimethylcyclopentyl)-1,3-dimethylimidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 114548654 |
| Molecular Formula | C15H23ClN4 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 5-(1-chloroethyl)-6-(3,3-dimethylcyclopentyl)-1,3-dimethylimidazo[4,5-d]pyrazole |
| SMILES | Cc1nn(C)c2c1nc(C(C)Cl)n2C1CCC(C)(C)C1 |
| InChI | InChI=1S/C15H23ClN4/c1-9(16)13-17-12-10(2)18-19(5)14(12)20(13)11-6-7-15(3,4)8-11/h9,11H,6-8H2,1-5H3 |
| InChIKey | HPOYJIQNRWNEFX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|