About 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile
2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile (PubChem CID 114548704) has the molecular formula C17H20ClN3
and a molecular weight of 301.82 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile |
| PubChem CID | 114548704 |
| Molecular Formula | C17H20ClN3 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile |
| SMILES | CC(Cl)c1nc2c(C#N)cccc2n1C1CCC(C)(C)C1 |
| InChI | InChI=1S/C17H20ClN3/c1-11(18)16-20-15-12(10-19)5-4-6-14(15)21(16)13-7-8-17(2,3)9-13/h4-6,11,13H,7-9H2,1-3H3 |
| InChIKey | UTQSOZLMIMOILR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile?
The IUPAC name of 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile (CID 114548704) is 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile.
What is the SMILES notation for 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile?
The canonical SMILES for 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile is CC(Cl)c1nc2c(C#N)cccc2n1C1CCC(C)(C)C1.
What is the InChIKey of 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile?
The InChIKey is UTQSOZLMIMOILR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3/c1-11(18)16-20-15-12(10-19)5-4-6-14(15)21(16)13-7-8-17(2,3)9-13/h4-6,11,13H,7-9H2,1-3H3.
What are the key properties of 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile?
2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile has a molecular weight of 301.82 g/mol, XLogP of 4.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)benzimidazole-4-carbonitrile is sourced from PubChem (CID 114548704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).