About octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate
octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate (PubChem CID 11454945) has the molecular formula C17H44NO6PSSi3
and a molecular weight of 505.84 g/mol. Its IUPAC name is octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate.
Molecular Properties
| Compound Name | octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate |
| PubChem CID | 11454945 |
| Molecular Formula | C17H44NO6PSSi3 |
| Molecular Weight | 505.84 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate |
| SMILES | CCCCCCCCOS(=O)(=O)N=P(O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H44NO6PSSi3/c1-11-12-13-14-15-16-17-21-26(19,20)18-25(22-27(2,3)4,23-28(5,6)7)24-29(8,9)10/h11-17H2,1-10H3 |
| InChIKey | XIEHZQGNZJWOFU-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.84 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate?
The IUPAC name of octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate (CID 11454945) is octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate.
What is the SMILES notation for octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate?
The canonical SMILES for octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate is CCCCCCCCOS(=O)(=O)N=P(O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate?
The InChIKey is XIEHZQGNZJWOFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H44NO6PSSi3/c1-11-12-13-14-15-16-17-21-26(19,20)18-25(22-27(2,3)4,23-28(5,6)7)24-29(8,9)10/h11-17H2,1-10H3.
What are the key properties of octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate?
octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate has a molecular weight of 505.84 g/mol, XLogP of 7.11, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for octyl N-[tris(trimethylsilyloxy)-λ5-phosphanylidene]sulfamate is sourced from PubChem (CID 11454945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).