C23H47BrO3Si2 — CID 11454975
[(2S,3S,5Z,8R)-8-[(1S)-1-bromopropyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,7,8-tetrahydro-2H-oxocin-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11454975) has the molecular formula C23H47BrO3Si2 and a molecular weight of 507.70 g/mol. Its IUPAC name is [(2S,3S,5Z,8R)-8-[(1S)-1-bromopropyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,7,8-tetrahydro-2H-oxocin-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3S,5Z,8R)-8-[(1S)-1-bromopropyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,7,8-tetrahydro-2H-oxocin-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11454975 |
| Molecular Formula | C23H47BrO3Si2 |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | [(2S,3S,5Z,8R)-8-[(1S)-1-bromopropyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,7,8-tetrahydro-2H-oxocin-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC[C@H](Br)[C@H]1C/C=C\C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H47BrO3Si2/c1-12-18(24)19-15-13-14-16-20(27-29(10,11)23(5,6)7)21(26-19)17-25-28(8,9)22(2,3)4/h13-14,18-21H,12,15-17H2,1-11H3/b14-13-/t18-,19+,20-,21-/m0/s1 |
| InChIKey | AELNKDLICISRTD-PCQJNFEKSA-N |
| XLogP | 7.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|