C14H17Cl2NO2 — CID 114549918
3,5-dichloro-4-methoxy-N-(3-methylcyclopentyl)benzamide (PubChem CID 114549918) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is 3,5-dichloro-4-methoxy-N-(3-methylcyclopentyl)benzamide.
| Compound Name | 3,5-dichloro-4-methoxy-N-(3-methylcyclopentyl)benzamide |
|---|---|
| PubChem CID | 114549918 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 3,5-dichloro-4-methoxy-N-(3-methylcyclopentyl)benzamide |
| SMILES | COc1c(Cl)cc(C(=O)NC2CCC(C)C2)cc1Cl |
| InChI | InChI=1S/C14H17Cl2NO2/c1-8-3-4-10(5-8)17-14(18)9-6-11(15)13(19-2)12(16)7-9/h6-8,10H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | BVLZWSHIUXDQKE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |