C29H48O7 — CID 11454998
(9E)-4,7,8-trihydroxy-12-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7,11-trimethyl-1-oxacyclododec-9-en-2-one (PubChem CID 11454998) has the molecular formula C29H48O7 and a molecular weight of 508.70 g/mol. Its IUPAC name is (9E)-4,7,8-trihydroxy-12-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7,11-trimethyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (9E)-4,7,8-trihydroxy-12-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7,11-trimethyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 11454998 |
| Molecular Formula | C29H48O7 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | (9E)-4,7,8-trihydroxy-12-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7,11-trimethyl-1-oxacyclododec-9-en-2-one |
| SMILES | CCC(O)C(C)C1OC1CC(C)/C=C/C=C(\C)C1OC(=O)C(C)C(O)CCC(C)(O)C(O)/C=C/C1C |
| InChI | InChI=1S/C29H48O7/c1-8-22(30)20(5)27-24(35-27)16-17(2)10-9-11-18(3)26-19(4)12-13-25(32)29(7,34)15-14-23(31)21(6)28(33)36-26/h9-13,17,19-27,30-32,34H,8,14-16H2,1-7H3/b10-9+,13-12+,18-11+ |
| InChIKey | VHBRTKVFIAIYGJ-GPFOKXNUSA-N |
| XLogP | 3.70 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|