C28H54O4Si2 — CID 11455027
(3aR,5aR,6R,7S,9aS,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a,9b-trimethyl-3,3a,4,5,5a,7,8,9-octahydrobenzo[g][2]benzofuran-1-one (PubChem CID 11455027) has the molecular formula C28H54O4Si2 and a molecular weight of 510.91 g/mol. Its IUPAC name is (3aR,5aR,6R,7S,9aS,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a,9b-trimethyl-3,3a,4,5,5a,7,8,9-octahydrobenzo[g][2]benzofuran-1-one.
| Compound Name | (3aR,5aR,6R,7S,9aS,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a,9b-trimethyl-3,3a,4,5,5a,7,8,9-octahydrobenzo[g][2]benzofuran-1-one |
|---|---|
| PubChem CID | 11455027 |
| Molecular Formula | C28H54O4Si2 |
| Molecular Weight | 510.91 g/mol |
| Exact Mass | 510.36 |
| IUPAC Name | (3aR,5aR,6R,7S,9aS,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a,9b-trimethyl-3,3a,4,5,5a,7,8,9-octahydrobenzo[g][2]benzofuran-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@]2(C)[C@H]1CC[C@H]1COC(=O)[C@@]12C |
| InChI | InChI=1S/C28H54O4Si2/c1-24(2,3)33(10,11)31-19-26(7)21-15-14-20-18-30-23(29)28(20,9)27(21,8)17-16-22(26)32-34(12,13)25(4,5)6/h20-22H,14-19H2,1-13H3/t20-,21-,22-,26-,27-,28+/m0/s1 |
| InChIKey | WBLQNPQGSQKCIG-ZIHGTXOFSA-N |
| XLogP | 7.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.91 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|