C15H26N2S — CID 114550565
1-(2-bicyclo[2.2.1]heptanyl)-3-(3,3-dimethylcyclopentyl)thiourea (PubChem CID 114550565) has the molecular formula C15H26N2S and a molecular weight of 266.45 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-3-(3,3-dimethylcyclopentyl)thiourea.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-(3,3-dimethylcyclopentyl)thiourea |
|---|---|
| PubChem CID | 114550565 |
| Molecular Formula | C15H26N2S |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-(3,3-dimethylcyclopentyl)thiourea |
| SMILES | CC1(C)CCC(NC(=S)NC2CC3CCC2C3)C1 |
| InChI | InChI=1S/C15H26N2S/c1-15(2)6-5-12(9-15)16-14(18)17-13-8-10-3-4-11(13)7-10/h10-13H,3-9H2,1-2H3,(H2,16,17,18) |
| InChIKey | IOYCDEKBWFIEPC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|