C34H30O5 — CID 11455144
[(1R,2S,3R,4R,5R)-2,5-dibenzoyl-4-ethoxy-3-hydroxy-3-phenylcyclopentyl]-phenylmethanone (PubChem CID 11455144) has the molecular formula C34H30O5 and a molecular weight of 518.61 g/mol. Its IUPAC name is [(1R,2S,3R,4R,5R)-2,5-dibenzoyl-4-ethoxy-3-hydroxy-3-phenylcyclopentyl]-phenylmethanone.
| Compound Name | [(1R,2S,3R,4R,5R)-2,5-dibenzoyl-4-ethoxy-3-hydroxy-3-phenylcyclopentyl]-phenylmethanone |
|---|---|
| PubChem CID | 11455144 |
| Molecular Formula | C34H30O5 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | [(1R,2S,3R,4R,5R)-2,5-dibenzoyl-4-ethoxy-3-hydroxy-3-phenylcyclopentyl]-phenylmethanone |
| SMILES | CCO[C@@H]1[C@H](C(=O)c2ccccc2)[C@@H](C(=O)c2ccccc2)[C@H](C(=O)c2ccccc2)[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C34H30O5/c1-2-39-33-28(31(36)24-17-9-4-10-18-24)27(30(35)23-15-7-3-8-16-23)29(32(37)25-19-11-5-12-20-25)34(33,38)26-21-13-6-14-22-26/h3-22,27-29,33,38H,2H2,1H3/t27-,28+,29-,33-,34+/m1/s1 |
| InChIKey | WKPXNYYVVYWNCO-SSZRAVJVSA-N |
| XLogP | 5.79 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |