About N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine
N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine (PubChem CID 114551776) has the molecular formula C14H24N4O2S
and a molecular weight of 312.44 g/mol. Its IUPAC name is N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine |
| PubChem CID | 114551776 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine |
| SMILES | CNCc1ccc(S(=O)(=O)N2CC(C)N(C)C(C)C2)nc1 |
| InChI | InChI=1S/C14H24N4O2S/c1-11-9-18(10-12(2)17(11)4)21(19,20)14-6-5-13(7-15-3)8-16-14/h5-6,8,11-12,15H,7,9-10H2,1-4H3 |
| InChIKey | FFYQBDQFCNJAKJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine?
The IUPAC name of N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine (CID 114551776) is N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine.
What is the SMILES notation for N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine?
The canonical SMILES for N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine is CNCc1ccc(S(=O)(=O)N2CC(C)N(C)C(C)C2)nc1.
What is the InChIKey of N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine?
The InChIKey is FFYQBDQFCNJAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O2S/c1-11-9-18(10-12(2)17(11)4)21(19,20)14-6-5-13(7-15-3)8-16-14/h5-6,8,11-12,15H,7,9-10H2,1-4H3.
What are the key properties of N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine?
N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine has a molecular weight of 312.44 g/mol, XLogP of 0.51, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[6-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-3-pyridinyl]methanamine is sourced from PubChem (CID 114551776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).