About 6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one
6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one (PubChem CID 114552420) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is 6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one.
Molecular Properties
| Compound Name | 6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one |
| PubChem CID | 114552420 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one |
| SMILES | CC1(C)CCC(N2CNC3(CC3)C2=O)C1 |
| InChI | InChI=1S/C12H20N2O/c1-11(2)4-3-9(7-11)14-8-13-12(5-6-12)10(14)15/h9,13H,3-8H2,1-2H3 |
| InChIKey | HMSHHBOYGZGURC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one?
The IUPAC name of 6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one (CID 114552420) is 6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one.
What is the SMILES notation for 6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one?
The canonical SMILES for 6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one is CC1(C)CCC(N2CNC3(CC3)C2=O)C1.
What is the InChIKey of 6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one?
The InChIKey is HMSHHBOYGZGURC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-11(2)4-3-9(7-11)14-8-13-12(5-6-12)10(14)15/h9,13H,3-8H2,1-2H3.
What are the key properties of 6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one?
6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one has a molecular weight of 208.30 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,3-dimethylcyclopentyl)-4,6-diazaspiro[2.4]heptan-7-one is sourced from PubChem (CID 114552420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).