C13H8Cl2N4O — CID 114552818
4-(2,6-dichlorophenyl)-3-pyrimidin-2-yl-1,2-oxazol-5-amine (PubChem CID 114552818) has the molecular formula C13H8Cl2N4O and a molecular weight of 307.14 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-3-pyrimidin-2-yl-1,2-oxazol-5-amine.
| Compound Name | 4-(2,6-dichlorophenyl)-3-pyrimidin-2-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 114552818 |
| Molecular Formula | C13H8Cl2N4O |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-3-pyrimidin-2-yl-1,2-oxazol-5-amine |
| SMILES | Nc1onc(-c2ncccn2)c1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H8Cl2N4O/c14-7-3-1-4-8(15)9(7)10-11(19-20-12(10)16)13-17-5-2-6-18-13/h1-6H,16H2 |
| InChIKey | OKIZDTUANCKCMC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |