C10H10IN3O2 — CID 114553507
2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-iodopyridazin-3-one (PubChem CID 114553507) has the molecular formula C10H10IN3O2 and a molecular weight of 331.11 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-iodopyridazin-3-one.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-iodopyridazin-3-one |
|---|---|
| PubChem CID | 114553507 |
| Molecular Formula | C10H10IN3O2 |
| Molecular Weight | 331.11 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-iodopyridazin-3-one |
| SMILES | Cc1nc(Cn2ncc(I)cc2=O)oc1C |
| InChI | InChI=1S/C10H10IN3O2/c1-6-7(2)16-9(13-6)5-14-10(15)3-8(11)4-12-14/h3-4H,5H2,1-2H3 |
| InChIKey | PRLXYRJBGQDGGO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.11 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|