C8H7IN4O — CID 114553934
5-iodo-2-(2-methylpyrazol-3-yl)-1H-pyrimidin-6-one (PubChem CID 114553934) has the molecular formula C8H7IN4O and a molecular weight of 302.08 g/mol. Its IUPAC name is 5-iodo-2-(2-methylpyrazol-3-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-2-(2-methylpyrazol-3-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114553934 |
| Molecular Formula | C8H7IN4O |
| Molecular Weight | 302.08 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 5-iodo-2-(2-methylpyrazol-3-yl)-1H-pyrimidin-6-one |
| SMILES | Cn1nccc1-c1ncc(I)c(=O)[nH]1 |
| InChI | InChI=1S/C8H7IN4O/c1-13-6(2-3-11-13)7-10-4-5(9)8(14)12-7/h2-4H,1H3,(H,10,12,14) |
| InChIKey | CWFGSTPLBPRYLU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.08 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|