C31H37ClN4O2 — CID 11455410
2-(1H-indol-3-yl)ethyl N-[7-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]heptyl]carbamate (PubChem CID 11455410) has the molecular formula C31H37ClN4O2 and a molecular weight of 533.12 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)ethyl N-[7-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]heptyl]carbamate.
| Compound Name | 2-(1H-indol-3-yl)ethyl N-[7-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]heptyl]carbamate |
|---|---|
| PubChem CID | 11455410 |
| Molecular Formula | C31H37ClN4O2 |
| Molecular Weight | 533.12 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 2-(1H-indol-3-yl)ethyl N-[7-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]heptyl]carbamate |
| SMILES | O=C(NCCCCCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2)OCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C31H37ClN4O2/c32-23-14-15-26-29(20-23)36-28-13-7-5-11-25(28)30(26)33-17-8-2-1-3-9-18-34-31(37)38-19-16-22-21-35-27-12-6-4-10-24(22)27/h4,6,10,12,14-15,20-21,35H,1-3,5,7-9,11,13,16-19H2,(H,33,36)(H,34,37) |
| InChIKey | ZFUVJAHCCTWEQC-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.12 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|