C31H40N2O4S — CID 11455457
(2S,3S)-N,N-dibenzyl-5-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2,3-dimethyl-5-oxopentanamide (PubChem CID 11455457) has the molecular formula C31H40N2O4S and a molecular weight of 536.74 g/mol. Its IUPAC name is (2S,3S)-N,N-dibenzyl-5-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2,3-dimethyl-5-oxopentanamide.
| Compound Name | (2S,3S)-N,N-dibenzyl-5-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2,3-dimethyl-5-oxopentanamide |
|---|---|
| PubChem CID | 11455457 |
| Molecular Formula | C31H40N2O4S |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | (2S,3S)-N,N-dibenzyl-5-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2,3-dimethyl-5-oxopentanamide |
| SMILES | C[C@H](C(=O)N(Cc1ccccc1)Cc1ccccc1)[C@@H](C)CC(=O)N1[C@H]2C[C@@H]3CC[C@@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C31H40N2O4S/c1-22(17-28(34)33-27-18-26-15-16-31(27,30(26,3)4)21-38(33,36)37)23(2)29(35)32(19-24-11-7-5-8-12-24)20-25-13-9-6-10-14-25/h5-14,22-23,26-27H,15-21H2,1-4H3/t22-,23-,26-,27-,31-/m0/s1 |
| InChIKey | BEPWJCBGRKXLQG-RKISSATPSA-N |
| XLogP | 5.24 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |