C26H44INOSi — CID 11455515
(1R,2S,3R,6R)-6-[(1S,2E)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylpenta-2,4-dienyl]-2-[(E)-4-iodo-3-methylbut-3-enyl]-2,3-dimethylcyclohexane-1-carbonitrile (PubChem CID 11455515) has the molecular formula C26H44INOSi and a molecular weight of 541.63 g/mol. Its IUPAC name is (1R,2S,3R,6R)-6-[(1S,2E)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylpenta-2,4-dienyl]-2-[(E)-4-iodo-3-methylbut-3-enyl]-2,3-dimethylcyclohexane-1-carbonitrile.
| Compound Name | (1R,2S,3R,6R)-6-[(1S,2E)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylpenta-2,4-dienyl]-2-[(E)-4-iodo-3-methylbut-3-enyl]-2,3-dimethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 11455515 |
| Molecular Formula | C26H44INOSi |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | (1R,2S,3R,6R)-6-[(1S,2E)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylpenta-2,4-dienyl]-2-[(E)-4-iodo-3-methylbut-3-enyl]-2,3-dimethylcyclohexane-1-carbonitrile |
| SMILES | C=C/C(C)=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC[C@@H](C)[C@](C)(CC/C(C)=C/I)[C@@H]1C#N |
| InChI | InChI=1S/C26H44INOSi/c1-11-19(2)16-24(29-30(9,10)25(5,6)7)22-13-12-21(4)26(8,23(22)18-28)15-14-20(3)17-27/h11,16-17,21-24H,1,12-15H2,2-10H3/b19-16+,20-17+/t21-,22-,23-,24-,26+/m1/s1 |
| InChIKey | NXTFGQNJPJGORS-BGPLXQQPSA-N |
| XLogP | 8.82 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|