C13H8Br4O4 — CID 11455599
3,4-dibromo-5-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]benzene-1,2-diol (PubChem CID 11455599) has the molecular formula C13H8Br4O4 and a molecular weight of 547.82 g/mol. Its IUPAC name is 3,4-dibromo-5-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]benzene-1,2-diol.
| Compound Name | 3,4-dibromo-5-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 11455599 |
| Molecular Formula | C13H8Br4O4 |
| Molecular Weight | 547.82 g/mol |
| Exact Mass | 543.72 |
| IUPAC Name | 3,4-dibromo-5-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]benzene-1,2-diol |
| SMILES | Oc1cc(Cc2cc(O)c(O)c(Br)c2Br)c(Br)c(Br)c1O |
| InChI | InChI=1S/C13H8Br4O4/c14-8-4(2-6(18)12(20)10(8)16)1-5-3-7(19)13(21)11(17)9(5)15/h2-3,18-21H,1H2 |
| InChIKey | WIAKRAUTQVUHHL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.82 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|